C23H29ClF3N3O3 — CID 19781163
2-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]-2-(trifluoromethyl)phenyl]guanidine;hydrochloride (PubChem CID 19781163) has the molecular formula C23H29ClF3N3O3 and a molecular weight of 487.95 g/mol. Its IUPAC name is 2-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]-2-(trifluoromethyl)phenyl]guanidine;hydrochloride.
| Compound Name | 2-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]-2-(trifluoromethyl)phenyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 19781163 |
| Molecular Formula | C23H29ClF3N3O3 |
| Molecular Weight | 487.95 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 2-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethoxy]-2-(trifluoromethyl)phenyl]guanidine;hydrochloride |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCOc1ccc(N=C(N)N)c(C(F)(F)F)c1)O2.Cl |
| InChI | InChI=1S/C23H28F3N3O3.ClH/c1-12-13(2)20-16(14(3)19(12)30)7-8-22(4,32-20)9-10-31-15-5-6-18(29-21(27)28)17(11-15)23(24,25)26;/h5-6,11,30H,7-10H2,1-4H3,(H4,27,28,29);1H |
| InChIKey | OTSOSNICDJWOLR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.95 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|