About 1-benzofuran;hydrochloride
1-benzofuran;hydrochloride (PubChem CID 19781165) has the molecular formula C8H7ClO
and a molecular weight of 154.60 g/mol. Its IUPAC name is 1-benzofuran;hydrochloride.
Molecular Properties
| Compound Name | 1-benzofuran;hydrochloride |
| PubChem CID | 19781165 |
| Molecular Formula | C8H7ClO |
| Molecular Weight | 154.60 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | 1-benzofuran;hydrochloride |
| SMILES | Cl.c1ccc2occc2c1 |
| InChI | InChI=1S/C8H6O.ClH/c1-2-4-8-7(3-1)5-6-9-8;/h1-6H;1H |
| InChIKey | QAPAAMJNJUBIMZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzofuran;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran;hydrochloride?
The IUPAC name of 1-benzofuran;hydrochloride (CID 19781165) is 1-benzofuran;hydrochloride.
What is the SMILES notation for 1-benzofuran;hydrochloride?
The canonical SMILES for 1-benzofuran;hydrochloride is Cl.c1ccc2occc2c1.
What is the InChIKey of 1-benzofuran;hydrochloride?
The InChIKey is QAPAAMJNJUBIMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.ClH/c1-2-4-8-7(3-1)5-6-9-8;/h1-6H;1H.
What are the key properties of 1-benzofuran;hydrochloride?
1-benzofuran;hydrochloride has a molecular weight of 154.60 g/mol, XLogP of 2.85, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran;hydrochloride is sourced from PubChem (CID 19781165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).