C5H3ClF8 — CID 19781241
1-chloro-1,1,2,4,4-pentafluoro-2-(trifluoromethyl)butane (PubChem CID 19781241) has the molecular formula C5H3ClF8 and a molecular weight of 250.52 g/mol. Its IUPAC name is 1-chloro-1,1,2,4,4-pentafluoro-2-(trifluoromethyl)butane.
| Compound Name | 1-chloro-1,1,2,4,4-pentafluoro-2-(trifluoromethyl)butane |
|---|---|
| PubChem CID | 19781241 |
| Molecular Formula | C5H3ClF8 |
| Molecular Weight | 250.52 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | 1-chloro-1,1,2,4,4-pentafluoro-2-(trifluoromethyl)butane |
| SMILES | FC(F)CC(F)(C(F)(F)F)C(F)(F)Cl |
| InChI | InChI=1S/C5H3ClF8/c6-4(10,11)3(9,1-2(7)8)5(12,13)14/h2H,1H2 |
| InChIKey | NZJODPRGAROQKZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|