C5H4ClF7 — CID 19781244
1-chloro-2-(difluoromethyl)-1,1,2,3,3-pentafluorobutane (PubChem CID 19781244) has the molecular formula C5H4ClF7 and a molecular weight of 232.53 g/mol. Its IUPAC name is 1-chloro-2-(difluoromethyl)-1,1,2,3,3-pentafluorobutane.
| Compound Name | 1-chloro-2-(difluoromethyl)-1,1,2,3,3-pentafluorobutane |
|---|---|
| PubChem CID | 19781244 |
| Molecular Formula | C5H4ClF7 |
| Molecular Weight | 232.53 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | 1-chloro-2-(difluoromethyl)-1,1,2,3,3-pentafluorobutane |
| SMILES | CC(F)(F)C(F)(C(F)F)C(F)(F)Cl |
| InChI | InChI=1S/C5H4ClF7/c1-3(9,10)4(11,2(7)8)5(6,12)13/h2H,1H3 |
| InChIKey | CKKKKIDNYMMFSD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|