About 3,5-dibromo-4-hydroxybenzonitrile;N,N-diethylethanamine
3,5-dibromo-4-hydroxybenzonitrile;N,N-diethylethanamine (PubChem CID 19781426) has the molecular formula C13H18Br2N2O
and a molecular weight of 378.11 g/mol. Its IUPAC name is 3,5-dibromo-4-hydroxybenzonitrile;N,N-diethylethanamine.
Molecular Properties
| Compound Name | 3,5-dibromo-4-hydroxybenzonitrile;N,N-diethylethanamine |
| PubChem CID | 19781426 |
| Molecular Formula | C13H18Br2N2O |
| Molecular Weight | 378.11 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | 3,5-dibromo-4-hydroxybenzonitrile;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.N#Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C7H3Br2NO.C6H15N/c8-5-1-4(3-10)2-6(9)7(5)11;1-4-7(5-2)6-3/h1-2,11H;4-6H2,1-3H3 |
| InChIKey | VKAHKQXXBIYWIA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.11 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dibromo-4-hydroxybenzonitrile;N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-4-hydroxybenzonitrile;N,N-diethylethanamine?
The IUPAC name of 3,5-dibromo-4-hydroxybenzonitrile;N,N-diethylethanamine (CID 19781426) is 3,5-dibromo-4-hydroxybenzonitrile;N,N-diethylethanamine.
What is the SMILES notation for 3,5-dibromo-4-hydroxybenzonitrile;N,N-diethylethanamine?
The canonical SMILES for 3,5-dibromo-4-hydroxybenzonitrile;N,N-diethylethanamine is CCN(CC)CC.N#Cc1cc(Br)c(O)c(Br)c1.
What is the InChIKey of 3,5-dibromo-4-hydroxybenzonitrile;N,N-diethylethanamine?
The InChIKey is VKAHKQXXBIYWIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Br2NO.C6H15N/c8-5-1-4(3-10)2-6(9)7(5)11;1-4-7(5-2)6-3/h1-2,11H;4-6H2,1-3H3.
What are the key properties of 3,5-dibromo-4-hydroxybenzonitrile;N,N-diethylethanamine?
3,5-dibromo-4-hydroxybenzonitrile;N,N-diethylethanamine has a molecular weight of 378.11 g/mol, XLogP of 4.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-4-hydroxybenzonitrile;N,N-diethylethanamine is sourced from PubChem (CID 19781426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).