C15H10F3N3O2 — CID 19781665
1-(3-ethyl-2,4,6-trifluorophenyl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 19781665) has the molecular formula C15H10F3N3O2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 1-(3-ethyl-2,4,6-trifluorophenyl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-(3-ethyl-2,4,6-trifluorophenyl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19781665 |
| Molecular Formula | C15H10F3N3O2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 1-(3-ethyl-2,4,6-trifluorophenyl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCc1c(F)cc(F)c(-n2c(=O)[nH]c(=O)c3cccnc32)c1F |
| InChI | InChI=1S/C15H10F3N3O2/c1-2-7-9(16)6-10(17)12(11(7)18)21-13-8(4-3-5-19-13)14(22)20-15(21)23/h3-6H,2H2,1H3,(H,20,22,23) |
| InChIKey | ONDNEKADJJYQMZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |