C14H25F5O — CID 19782012
1-(3,3,4,4,4-pentafluorobutan-2-yloxy)decane (PubChem CID 19782012) has the molecular formula C14H25F5O and a molecular weight of 304.34 g/mol. Its IUPAC name is 1-(3,3,4,4,4-pentafluorobutan-2-yloxy)decane.
| Compound Name | 1-(3,3,4,4,4-pentafluorobutan-2-yloxy)decane |
|---|---|
| PubChem CID | 19782012 |
| Molecular Formula | C14H25F5O |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-(3,3,4,4,4-pentafluorobutan-2-yloxy)decane |
| SMILES | CCCCCCCCCCOC(C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H25F5O/c1-3-4-5-6-7-8-9-10-11-20-12(2)13(15,16)14(17,18)19/h12H,3-11H2,1-2H3 |
| InChIKey | UPNMZSCNWPVHMZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|