C18H30F8O — CID 19782060
2,2,3,3,4,4,5,5-octafluoro-1-hexoxydodecane (PubChem CID 19782060) has the molecular formula C18H30F8O and a molecular weight of 414.42 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-1-hexoxydodecane.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-1-hexoxydodecane |
|---|---|
| PubChem CID | 19782060 |
| Molecular Formula | C18H30F8O |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-1-hexoxydodecane |
| SMILES | CCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)COCCCCCC |
| InChI | InChI=1S/C18H30F8O/c1-3-5-7-9-10-12-15(19,20)17(23,24)18(25,26)16(21,22)14-27-13-11-8-6-4-2/h3-14H2,1-2H3 |
| InChIKey | WXOFUOOSGPASLB-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|