C24H26FNO5S — CID 19782183
2-[[5-[1-[(4-fluorophenyl)sulfonylamino]ethyl]-1,2,3,4,5,6-hexahydrophenanthren-9-yl]oxy]acetic acid (PubChem CID 19782183) has the molecular formula C24H26FNO5S and a molecular weight of 459.54 g/mol. Its IUPAC name is 2-[[5-[1-[(4-fluorophenyl)sulfonylamino]ethyl]-1,2,3,4,5,6-hexahydrophenanthren-9-yl]oxy]acetic acid.
| Compound Name | 2-[[5-[1-[(4-fluorophenyl)sulfonylamino]ethyl]-1,2,3,4,5,6-hexahydrophenanthren-9-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 19782183 |
| Molecular Formula | C24H26FNO5S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-[[5-[1-[(4-fluorophenyl)sulfonylamino]ethyl]-1,2,3,4,5,6-hexahydrophenanthren-9-yl]oxy]acetic acid |
| SMILES | CC(NS(=O)(=O)c1ccc(F)cc1)C1CC=Cc2c(OCC(=O)O)cc3c(c21)CCCC3 |
| InChI | InChI=1S/C24H26FNO5S/c1-15(26-32(29,30)18-11-9-17(25)10-12-18)19-7-4-8-21-22(31-14-23(27)28)13-16-5-2-3-6-20(16)24(19)21/h4,8-13,15,19,26H,2-3,5-7,14H2,1H3,(H,27,28) |
| InChIKey | NVUSDHVOMJLILB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |