C18H6Br10N2O4S2 — CID 19782262
2,3,4,5,6-pentabromo-N-[4-[(2,3,4,5,6-pentabromophenyl)sulfonylamino]phenyl]benzenesulfonamide (PubChem CID 19782262) has the molecular formula C18H6Br10N2O4S2 and a molecular weight of 1177.43 g/mol. Its IUPAC name is 2,3,4,5,6-pentabromo-N-[4-[(2,3,4,5,6-pentabromophenyl)sulfonylamino]phenyl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentabromo-N-[4-[(2,3,4,5,6-pentabromophenyl)sulfonylamino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19782262 |
| Molecular Formula | C18H6Br10N2O4S2 |
| Molecular Weight | 1177.43 g/mol |
| Exact Mass | 1167.16 |
| IUPAC Name | 2,3,4,5,6-pentabromo-N-[4-[(2,3,4,5,6-pentabromophenyl)sulfonylamino]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(NS(=O)(=O)c2c(Br)c(Br)c(Br)c(Br)c2Br)cc1)c1c(Br)c(Br)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C18H6Br10N2O4S2/c19-7-9(21)13(25)17(14(26)10(7)22)35(31,32)29-5-1-2-6(4-3-5)30-36(33,34)18-15(27)11(23)8(20)12(24)16(18)28/h1-4,29-30H |
| InChIKey | IATRMOSXHDWHJS-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1177.43 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|