About 1-ethyl-N,N-dimethyl-2H-pyridin-4-amine
1-ethyl-N,N-dimethyl-2H-pyridin-4-amine (PubChem CID 19782352) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-ethyl-N,N-dimethyl-2H-pyridin-4-amine.
Molecular Properties
| Compound Name | 1-ethyl-N,N-dimethyl-2H-pyridin-4-amine |
| PubChem CID | 19782352 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1-ethyl-N,N-dimethyl-2H-pyridin-4-amine |
| SMILES | CCN1C=CC(N(C)C)=CC1 |
| InChI | InChI=1S/C9H16N2/c1-4-11-7-5-9(6-8-11)10(2)3/h5-7H,4,8H2,1-3H3 |
| InChIKey | UGZTTWBVGNUEEL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-N,N-dimethyl-2H-pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N,N-dimethyl-2H-pyridin-4-amine?
The IUPAC name of 1-ethyl-N,N-dimethyl-2H-pyridin-4-amine (CID 19782352) is 1-ethyl-N,N-dimethyl-2H-pyridin-4-amine.
What is the SMILES notation for 1-ethyl-N,N-dimethyl-2H-pyridin-4-amine?
The canonical SMILES for 1-ethyl-N,N-dimethyl-2H-pyridin-4-amine is CCN1C=CC(N(C)C)=CC1.
What is the InChIKey of 1-ethyl-N,N-dimethyl-2H-pyridin-4-amine?
The InChIKey is UGZTTWBVGNUEEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-11-7-5-9(6-8-11)10(2)3/h5-7H,4,8H2,1-3H3.
What are the key properties of 1-ethyl-N,N-dimethyl-2H-pyridin-4-amine?
1-ethyl-N,N-dimethyl-2H-pyridin-4-amine has a molecular weight of 152.24 g/mol, XLogP of 1.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N,N-dimethyl-2H-pyridin-4-amine is sourced from PubChem (CID 19782352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).