About [2,4-bis(ethenyl)cyclopentyl]-triethoxysilane
[2,4-bis(ethenyl)cyclopentyl]-triethoxysilane (PubChem CID 19782609) has the molecular formula C15H28O3Si
and a molecular weight of 284.47 g/mol. Its IUPAC name is [2,4-bis(ethenyl)cyclopentyl]-triethoxysilane.
Molecular Properties
| Compound Name | [2,4-bis(ethenyl)cyclopentyl]-triethoxysilane |
| PubChem CID | 19782609 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | [2,4-bis(ethenyl)cyclopentyl]-triethoxysilane |
| SMILES | C=CC1CC(C=C)C([Si](OCC)(OCC)OCC)C1 |
| InChI | InChI=1S/C15H28O3Si/c1-6-13-11-14(7-2)15(12-13)19(16-8-3,17-9-4)18-10-5/h6-7,13-15H,1-2,8-12H2,3-5H3 |
| InChIKey | NZFLBQAETFFQGP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2,4-bis(ethenyl)cyclopentyl]-triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-bis(ethenyl)cyclopentyl]-triethoxysilane?
The IUPAC name of [2,4-bis(ethenyl)cyclopentyl]-triethoxysilane (CID 19782609) is [2,4-bis(ethenyl)cyclopentyl]-triethoxysilane.
What is the SMILES notation for [2,4-bis(ethenyl)cyclopentyl]-triethoxysilane?
The canonical SMILES for [2,4-bis(ethenyl)cyclopentyl]-triethoxysilane is C=CC1CC(C=C)C([Si](OCC)(OCC)OCC)C1.
What is the InChIKey of [2,4-bis(ethenyl)cyclopentyl]-triethoxysilane?
The InChIKey is NZFLBQAETFFQGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3Si/c1-6-13-11-14(7-2)15(12-13)19(16-8-3,17-9-4)18-10-5/h6-7,13-15H,1-2,8-12H2,3-5H3.
What are the key properties of [2,4-bis(ethenyl)cyclopentyl]-triethoxysilane?
[2,4-bis(ethenyl)cyclopentyl]-triethoxysilane has a molecular weight of 284.47 g/mol, XLogP of 3.80, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-bis(ethenyl)cyclopentyl]-triethoxysilane is sourced from PubChem (CID 19782609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).