C13H20O2 — CID 19782746
6-(5-hydroxypentyl)-3,3a,4,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 19782746) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 6-(5-hydroxypentyl)-3,3a,4,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | 6-(5-hydroxypentyl)-3,3a,4,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 19782746 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 6-(5-hydroxypentyl)-3,3a,4,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | O=C1CC2CC=C(CCCCCO)C2C1 |
| InChI | InChI=1S/C13H20O2/c14-7-3-1-2-4-10-5-6-11-8-12(15)9-13(10)11/h5,11,13-14H,1-4,6-9H2 |
| InChIKey | MPHUGOWNICIDNB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|