About 2,4-dibromobutanal
2,4-dibromobutanal (PubChem CID 19782773) has the molecular formula C4H6Br2O
and a molecular weight of 229.90 g/mol. Its IUPAC name is 2,4-dibromobutanal.
Molecular Properties
| Compound Name | 2,4-dibromobutanal |
| PubChem CID | 19782773 |
| Molecular Formula | C4H6Br2O |
| Molecular Weight | 229.90 g/mol |
| Exact Mass | 227.88 |
| IUPAC Name | 2,4-dibromobutanal |
| SMILES | O=CC(Br)CCBr |
| InChI | InChI=1S/C4H6Br2O/c5-2-1-4(6)3-7/h3-4H,1-2H2 |
| InChIKey | AMPUUPHHYIUQBE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.90 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibromobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromobutanal?
The IUPAC name of 2,4-dibromobutanal (CID 19782773) is 2,4-dibromobutanal.
What is the SMILES notation for 2,4-dibromobutanal?
The canonical SMILES for 2,4-dibromobutanal is O=CC(Br)CCBr.
What is the InChIKey of 2,4-dibromobutanal?
The InChIKey is AMPUUPHHYIUQBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6Br2O/c5-2-1-4(6)3-7/h3-4H,1-2H2.
What are the key properties of 2,4-dibromobutanal?
2,4-dibromobutanal has a molecular weight of 229.90 g/mol, XLogP of 1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromobutanal is sourced from PubChem (CID 19782773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).