About ethyl 4-oxooxane-3-carboxylate
ethyl 4-oxooxane-3-carboxylate (PubChem CID 19783095) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is ethyl 4-oxooxane-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-oxooxane-3-carboxylate |
| PubChem CID | 19783095 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | ethyl 4-oxooxane-3-carboxylate |
| SMILES | CCOC(=O)C1COCCC1=O |
| InChI | InChI=1S/C8H12O4/c1-2-12-8(10)6-5-11-4-3-7(6)9/h6H,2-5H2,1H3 |
| InChIKey | ZUJSLBBFQOCMFB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-oxooxane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-oxooxane-3-carboxylate?
The IUPAC name of ethyl 4-oxooxane-3-carboxylate (CID 19783095) is ethyl 4-oxooxane-3-carboxylate.
What is the SMILES notation for ethyl 4-oxooxane-3-carboxylate?
The canonical SMILES for ethyl 4-oxooxane-3-carboxylate is CCOC(=O)C1COCCC1=O.
What is the InChIKey of ethyl 4-oxooxane-3-carboxylate?
The InChIKey is ZUJSLBBFQOCMFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c1-2-12-8(10)6-5-11-4-3-7(6)9/h6H,2-5H2,1H3.
What are the key properties of ethyl 4-oxooxane-3-carboxylate?
ethyl 4-oxooxane-3-carboxylate has a molecular weight of 172.18 g/mol, XLogP of 0.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-oxooxane-3-carboxylate is sourced from PubChem (CID 19783095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).