C10H16N2O3 — CID 19783125
1,5-dipropyl-1,3-diazinane-2,4,6-trione (PubChem CID 19783125) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 1,5-dipropyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,5-dipropyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 19783125 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1,5-dipropyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCC1C(=O)NC(=O)N(CCC)C1=O |
| InChI | InChI=1S/C10H16N2O3/c1-3-5-7-8(13)11-10(15)12(6-4-2)9(7)14/h7H,3-6H2,1-2H3,(H,11,13,15) |
| InChIKey | XKRGMKDJYKNKKP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|