C10H11F10N — CID 19783528
2,2,3,3,4,4,5,5,6,6-decafluoro-1-pentylpiperidine (PubChem CID 19783528) has the molecular formula C10H11F10N and a molecular weight of 335.19 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-1-pentylpiperidine.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-pentylpiperidine |
|---|---|
| PubChem CID | 19783528 |
| Molecular Formula | C10H11F10N |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-pentylpiperidine |
| SMILES | CCCCCN1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H11F10N/c1-2-3-4-5-21-9(17,18)7(13,14)6(11,12)8(15,16)10(21,19)20/h2-5H2,1H3 |
| InChIKey | KCNWTMXIAVBVSS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|