C9H11F8NO — CID 19783531
2,2,3,3,5,5,6,6-octafluoro-4-pentylmorpholine (PubChem CID 19783531) has the molecular formula C9H11F8NO and a molecular weight of 301.18 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octafluoro-4-pentylmorpholine.
| Compound Name | 2,2,3,3,5,5,6,6-octafluoro-4-pentylmorpholine |
|---|---|
| PubChem CID | 19783531 |
| Molecular Formula | C9H11F8NO |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octafluoro-4-pentylmorpholine |
| SMILES | CCCCCN1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C9H11F8NO/c1-2-3-4-5-18-6(10,11)8(14,15)19-9(16,17)7(18,12)13/h2-5H2,1H3 |
| InChIKey | MVXWRSZCKJIDMS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|