C11H13F10N — CID 19783532
2,2,3,3,4,4,5,5,6,6-decafluoro-1-hexylpiperidine (PubChem CID 19783532) has the molecular formula C11H13F10N and a molecular weight of 349.21 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-1-hexylpiperidine.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-hexylpiperidine |
|---|---|
| PubChem CID | 19783532 |
| Molecular Formula | C11H13F10N |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-hexylpiperidine |
| SMILES | CCCCCCN1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H13F10N/c1-2-3-4-5-6-22-10(18,19)8(14,15)7(12,13)9(16,17)11(22,20)21/h2-6H2,1H3 |
| InChIKey | GDKDXYJHHWLMFY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|