C9H7F11O — CID 19783535
2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxolane (PubChem CID 19783535) has the molecular formula C9H7F11O and a molecular weight of 340.13 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxolane.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxolane |
|---|---|
| PubChem CID | 19783535 |
| Molecular Formula | C9H7F11O |
| Molecular Weight | 340.13 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxolane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1CCCO1 |
| InChI | InChI=1S/C9H7F11O/c10-5(11,4-2-1-3-21-4)6(12,13)7(14,15)8(16,17)9(18,19)20/h4H,1-3H2 |
| InChIKey | VHWFBNNZNFSLFH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.13 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|