C9F21N — CID 19783536
1,1,2,2,3,3,4,4,5,5,5-undecafluoro-N,N-bis(1,1,2,2,2-pentafluoroethyl)pentan-1-amine (PubChem CID 19783536) has the molecular formula C9F21N and a molecular weight of 521.06 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,5-undecafluoro-N,N-bis(1,1,2,2,2-pentafluoroethyl)pentan-1-amine.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,5-undecafluoro-N,N-bis(1,1,2,2,2-pentafluoroethyl)pentan-1-amine |
|---|---|
| PubChem CID | 19783536 |
| Molecular Formula | C9F21N |
| Molecular Weight | 521.06 g/mol |
| Exact Mass | 520.97 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,5-undecafluoro-N,N-bis(1,1,2,2,2-pentafluoroethyl)pentan-1-amine |
| SMILES | FC(F)(F)C(F)(F)N(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9F21N/c10-1(11,2(12,13)4(16,17)18)3(14,15)7(25,26)31(8(27,28)5(19,20)21)9(29,30)6(22,23)24 |
| InChIKey | WBQMKAKILKYGRY-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.06 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|