C9H9F10N — CID 19783538
1-butyl-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine (PubChem CID 19783538) has the molecular formula C9H9F10N and a molecular weight of 321.16 g/mol. Its IUPAC name is 1-butyl-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine.
| Compound Name | 1-butyl-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine |
|---|---|
| PubChem CID | 19783538 |
| Molecular Formula | C9H9F10N |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 1-butyl-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine |
| SMILES | CCCCN1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H9F10N/c1-2-3-4-20-8(16,17)6(12,13)5(10,11)7(14,15)9(20,18)19/h2-4H2,1H3 |
| InChIKey | SUUZMCVCFBJQHR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|