C12H18N4S — CID 19783556
3-(1,3-diaminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,5-diene-1,3-diamine (PubChem CID 19783556) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is 3-(1,3-diaminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,5-diene-1,3-diamine.
| Compound Name | 3-(1,3-diaminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,5-diene-1,3-diamine |
|---|---|
| PubChem CID | 19783556 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3-(1,3-diaminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,5-diene-1,3-diamine |
| SMILES | NC1=CC(N)(SC2(N)C=C(N)C=CC2)CC=C1 |
| InChI | InChI=1S/C12H18N4S/c13-9-3-1-5-11(15,7-9)17-12(16)6-2-4-10(14)8-12/h1-4,7-8H,5-6,13-16H2 |
| InChIKey | APISINPZHBQVEJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|