About 1-(1,2-diaminoethyl)pyrrole-2,5-dione
1-(1,2-diaminoethyl)pyrrole-2,5-dione (PubChem CID 19783560) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is 1-(1,2-diaminoethyl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-(1,2-diaminoethyl)pyrrole-2,5-dione |
| PubChem CID | 19783560 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 1-(1,2-diaminoethyl)pyrrole-2,5-dione |
| SMILES | NCC(N)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C6H9N3O2/c7-3-4(8)9-5(10)1-2-6(9)11/h1-2,4H,3,7-8H2 |
| InChIKey | UUCXQMXVDZQGLT-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2-diaminoethyl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-diaminoethyl)pyrrole-2,5-dione?
The IUPAC name of 1-(1,2-diaminoethyl)pyrrole-2,5-dione (CID 19783560) is 1-(1,2-diaminoethyl)pyrrole-2,5-dione.
What is the SMILES notation for 1-(1,2-diaminoethyl)pyrrole-2,5-dione?
The canonical SMILES for 1-(1,2-diaminoethyl)pyrrole-2,5-dione is NCC(N)N1C(=O)C=CC1=O.
What is the InChIKey of 1-(1,2-diaminoethyl)pyrrole-2,5-dione?
The InChIKey is UUCXQMXVDZQGLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2/c7-3-4(8)9-5(10)1-2-6(9)11/h1-2,4H,3,7-8H2.
What are the key properties of 1-(1,2-diaminoethyl)pyrrole-2,5-dione?
1-(1,2-diaminoethyl)pyrrole-2,5-dione has a molecular weight of 155.16 g/mol, XLogP of -1.85, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-diaminoethyl)pyrrole-2,5-dione is sourced from PubChem (CID 19783560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).