About 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate;prop-2-enoic acid
2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate;prop-2-enoic acid (PubChem CID 19784057) has the molecular formula C21H28N2O10
and a molecular weight of 468.46 g/mol. Its IUPAC name is 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate;prop-2-enoic acid.
Molecular Properties
| Compound Name | 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate;prop-2-enoic acid |
| PubChem CID | 19784057 |
| Molecular Formula | C21H28N2O10 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CC(=O)OCCONC(=O)Cc1cccc(CC(=O)NOCCOC(C)=O)c1 |
| InChI | InChI=1S/C18H24N2O8.C3H4O2/c1-13(21)25-6-8-27-19-17(23)11-15-4-3-5-16(10-15)12-18(24)20-28-9-7-26-14(2)22;1-2-3(4)5/h3-5,10H,6-9,11-12H2,1-2H3,(H,19,23)(H,20,24);2H,1H2,(H,4,5) |
| InChIKey | UFVRRCBTKCXHQH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate;prop-2-enoic acid?
The IUPAC name of 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate;prop-2-enoic acid (CID 19784057) is 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate;prop-2-enoic acid.
What is the SMILES notation for 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate;prop-2-enoic acid?
The canonical SMILES for 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate;prop-2-enoic acid is C=CC(=O)O.CC(=O)OCCONC(=O)Cc1cccc(CC(=O)NOCCOC(C)=O)c1.
What is the InChIKey of 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate;prop-2-enoic acid?
The InChIKey is UFVRRCBTKCXHQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O8.C3H4O2/c1-13(21)25-6-8-27-19-17(23)11-15-4-3-5-16(10-15)12-18(24)20-28-9-7-26-14(2)22;1-2-3(4)5/h3-5,10H,6-9,11-12H2,1-2H3,(H,19,23)(H,20,24);2H,1H2,(H,4,5).
What are the key properties of 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate;prop-2-enoic acid?
2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate;prop-2-enoic acid has a molecular weight of 468.46 g/mol, XLogP of 0.25, 13 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[3-[2-(2-acetyloxyethoxyamino)-2-oxoethyl]phenyl]acetyl]amino]oxyethyl acetate;prop-2-enoic acid is sourced from PubChem (CID 19784057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).