C23H22F3NO2 — CID 19784242
2,2,2-trifluoro-N-[2-[2-(2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethynyl]phenyl]acetamide (PubChem CID 19784242) has the molecular formula C23H22F3NO2 and a molecular weight of 401.43 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[2-(2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethynyl]phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[2-(2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethynyl]phenyl]acetamide |
|---|---|
| PubChem CID | 19784242 |
| Molecular Formula | C23H22F3NO2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[2-(2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethynyl]phenyl]acetamide |
| SMILES | Cc1cc(C)c2c(c1C)OC(C)(C#Cc1ccccc1NC(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C23H22F3NO2/c1-14-13-15(2)18-10-12-22(4,29-20(18)16(14)3)11-9-17-7-5-6-8-19(17)27-21(28)23(24,25)26/h5-8,13H,10,12H2,1-4H3,(H,27,28) |
| InChIKey | SURHXEJOYWRYLA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|