C17H17ClN2 — CID 19784474
6-chloro-2,3-dimethyl-4-phenyl-4,5-dihydro-1,3-benzodiazepine (PubChem CID 19784474) has the molecular formula C17H17ClN2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 6-chloro-2,3-dimethyl-4-phenyl-4,5-dihydro-1,3-benzodiazepine.
| Compound Name | 6-chloro-2,3-dimethyl-4-phenyl-4,5-dihydro-1,3-benzodiazepine |
|---|---|
| PubChem CID | 19784474 |
| Molecular Formula | C17H17ClN2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 6-chloro-2,3-dimethyl-4-phenyl-4,5-dihydro-1,3-benzodiazepine |
| SMILES | CC1=Nc2cccc(Cl)c2CC(c2ccccc2)N1C |
| InChI | InChI=1S/C17H17ClN2/c1-12-19-16-10-6-9-15(18)14(16)11-17(20(12)2)13-7-4-3-5-8-13/h3-10,17H,11H2,1-2H3 |
| InChIKey | OCLSBPLXNMNOOH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |