C20H33NO — CID 19784669
3-[(4-tert-butylphenyl)methyl]-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 19784669) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)methyl]-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 3-[(4-tert-butylphenyl)methyl]-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 19784669 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 3-[(4-tert-butylphenyl)methyl]-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(O)C(Cc2ccc(C(C)(C)C)cc2)C(C)(C)N1 |
| InChI | InChI=1S/C20H33NO/c1-18(2,3)15-10-8-14(9-11-15)12-16-17(22)13-19(4,5)21-20(16,6)7/h8-11,16-17,21-22H,12-13H2,1-7H3 |
| InChIKey | MDXURRTYQFQRLH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |