About 5-methyl-2,3-diphenyl-1H-pyrrole
5-methyl-2,3-diphenyl-1H-pyrrole (PubChem CID 19784711) has the molecular formula C17H15N
and a molecular weight of 233.31 g/mol. Its IUPAC name is 5-methyl-2,3-diphenyl-1H-pyrrole.
Molecular Properties
| Compound Name | 5-methyl-2,3-diphenyl-1H-pyrrole |
| PubChem CID | 19784711 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 5-methyl-2,3-diphenyl-1H-pyrrole |
| SMILES | Cc1cc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C17H15N/c1-13-12-16(14-8-4-2-5-9-14)17(18-13)15-10-6-3-7-11-15/h2-12,18H,1H3 |
| InChIKey | IJZPUNJYBSHEJK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-methyl-2,3-diphenyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,3-diphenyl-1H-pyrrole?
The IUPAC name of 5-methyl-2,3-diphenyl-1H-pyrrole (CID 19784711) is 5-methyl-2,3-diphenyl-1H-pyrrole.
What is the SMILES notation for 5-methyl-2,3-diphenyl-1H-pyrrole?
The canonical SMILES for 5-methyl-2,3-diphenyl-1H-pyrrole is Cc1cc(-c2ccccc2)c(-c2ccccc2)[nH]1.
What is the InChIKey of 5-methyl-2,3-diphenyl-1H-pyrrole?
The InChIKey is IJZPUNJYBSHEJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N/c1-13-12-16(14-8-4-2-5-9-14)17(18-13)15-10-6-3-7-11-15/h2-12,18H,1H3.
What are the key properties of 5-methyl-2,3-diphenyl-1H-pyrrole?
5-methyl-2,3-diphenyl-1H-pyrrole has a molecular weight of 233.31 g/mol, XLogP of 4.66, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,3-diphenyl-1H-pyrrole is sourced from PubChem (CID 19784711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).