C34H52N2O10 — CID 19784855
bis[1-(3-methoxy-3-oxopropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] benzene-1,2-dicarboxylate (PubChem CID 19784855) has the molecular formula C34H52N2O10 and a molecular weight of 648.79 g/mol. Its IUPAC name is bis[1-(3-methoxy-3-oxopropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] benzene-1,2-dicarboxylate.
| Compound Name | bis[1-(3-methoxy-3-oxopropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 19784855 |
| Molecular Formula | C34H52N2O10 |
| Molecular Weight | 648.79 g/mol |
| Exact Mass | 648.36 |
| IUPAC Name | bis[1-(3-methoxy-3-oxopropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] benzene-1,2-dicarboxylate |
| SMILES | COC(=O)CCON1C(C)(C)CC(OC(=O)c2ccccc2C(=O)OC2CC(C)(C)N(OCCC(=O)OC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C34H52N2O10/c1-31(2)19-23(20-32(3,4)35(31)43-17-15-27(37)41-9)45-29(39)25-13-11-12-14-26(25)30(40)46-24-21-33(5,6)36(34(7,8)22-24)44-18-16-28(38)42-10/h11-14,23-24H,15-22H2,1-10H3 |
| InChIKey | SGBQVJUVOBHTNE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.79 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|