C24H25FN6O — CID 19785252
4-[[4-[[7-[(4-fluorophenyl)methyl]purin-8-yl]amino]piperidin-1-yl]methyl]phenol (PubChem CID 19785252) has the molecular formula C24H25FN6O and a molecular weight of 432.50 g/mol. Its IUPAC name is 4-[[4-[[7-[(4-fluorophenyl)methyl]purin-8-yl]amino]piperidin-1-yl]methyl]phenol.
| Compound Name | 4-[[4-[[7-[(4-fluorophenyl)methyl]purin-8-yl]amino]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 19785252 |
| Molecular Formula | C24H25FN6O |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 4-[[4-[[7-[(4-fluorophenyl)methyl]purin-8-yl]amino]piperidin-1-yl]methyl]phenol |
| SMILES | Oc1ccc(CN2CCC(Nc3nc4ncncc4n3Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H25FN6O/c25-19-5-1-18(2-6-19)15-31-22-13-26-16-27-23(22)29-24(31)28-20-9-11-30(12-10-20)14-17-3-7-21(32)8-4-17/h1-8,13,16,20,32H,9-12,14-15H2,(H,26,27,28,29) |
| InChIKey | QCEANUKCJLXGOR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |