About N-piperidin-4-yl-9-(1,3-thiazol-4-ylmethyl)purin-8-amine
N-piperidin-4-yl-9-(1,3-thiazol-4-ylmethyl)purin-8-amine (PubChem CID 19785361) has the molecular formula C14H17N7S
and a molecular weight of 315.41 g/mol. Its IUPAC name is N-piperidin-4-yl-9-(1,3-thiazol-4-ylmethyl)purin-8-amine.
Molecular Properties
| Compound Name | N-piperidin-4-yl-9-(1,3-thiazol-4-ylmethyl)purin-8-amine |
| PubChem CID | 19785361 |
| Molecular Formula | C14H17N7S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-piperidin-4-yl-9-(1,3-thiazol-4-ylmethyl)purin-8-amine |
| SMILES | c1ncc2nc(NC3CCNCC3)n(Cc3cscn3)c2n1 |
| InChI | InChI=1S/C14H17N7S/c1-3-15-4-2-10(1)19-14-20-12-5-16-8-17-13(12)21(14)6-11-7-22-9-18-11/h5,7-10,15H,1-4,6H2,(H,19,20) |
| InChIKey | SSDLKIXMXGLXFV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-piperidin-4-yl-9-(1,3-thiazol-4-ylmethyl)purin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-piperidin-4-yl-9-(1,3-thiazol-4-ylmethyl)purin-8-amine?
The IUPAC name of N-piperidin-4-yl-9-(1,3-thiazol-4-ylmethyl)purin-8-amine (CID 19785361) is N-piperidin-4-yl-9-(1,3-thiazol-4-ylmethyl)purin-8-amine.
What is the SMILES notation for N-piperidin-4-yl-9-(1,3-thiazol-4-ylmethyl)purin-8-amine?
The canonical SMILES for N-piperidin-4-yl-9-(1,3-thiazol-4-ylmethyl)purin-8-amine is c1ncc2nc(NC3CCNCC3)n(Cc3cscn3)c2n1.
What is the InChIKey of N-piperidin-4-yl-9-(1,3-thiazol-4-ylmethyl)purin-8-amine?
The InChIKey is SSDLKIXMXGLXFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N7S/c1-3-15-4-2-10(1)19-14-20-12-5-16-8-17-13(12)21(14)6-11-7-22-9-18-11/h5,7-10,15H,1-4,6H2,(H,19,20).
What are the key properties of N-piperidin-4-yl-9-(1,3-thiazol-4-ylmethyl)purin-8-amine?
N-piperidin-4-yl-9-(1,3-thiazol-4-ylmethyl)purin-8-amine has a molecular weight of 315.41 g/mol, XLogP of 1.50, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-piperidin-4-yl-9-(1,3-thiazol-4-ylmethyl)purin-8-amine is sourced from PubChem (CID 19785361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).