About 2-(2-hydrazinyl-4,5-dihydroimidazol-1-yl)ethanol
2-(2-hydrazinyl-4,5-dihydroimidazol-1-yl)ethanol (PubChem CID 19785397) has the molecular formula C5H12N4O
and a molecular weight of 144.18 g/mol. Its IUPAC name is 2-(2-hydrazinyl-4,5-dihydroimidazol-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2-hydrazinyl-4,5-dihydroimidazol-1-yl)ethanol |
| PubChem CID | 19785397 |
| Molecular Formula | C5H12N4O |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | 2-(2-hydrazinyl-4,5-dihydroimidazol-1-yl)ethanol |
| SMILES | NNC1=NCCN1CCO |
| InChI | InChI=1S/C5H12N4O/c6-8-5-7-1-2-9(5)3-4-10/h10H,1-4,6H2,(H,7,8) |
| InChIKey | LBICBILBQUERTK-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydrazinyl-4,5-dihydroimidazol-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydrazinyl-4,5-dihydroimidazol-1-yl)ethanol?
The IUPAC name of 2-(2-hydrazinyl-4,5-dihydroimidazol-1-yl)ethanol (CID 19785397) is 2-(2-hydrazinyl-4,5-dihydroimidazol-1-yl)ethanol.
What is the SMILES notation for 2-(2-hydrazinyl-4,5-dihydroimidazol-1-yl)ethanol?
The canonical SMILES for 2-(2-hydrazinyl-4,5-dihydroimidazol-1-yl)ethanol is NNC1=NCCN1CCO.
What is the InChIKey of 2-(2-hydrazinyl-4,5-dihydroimidazol-1-yl)ethanol?
The InChIKey is LBICBILBQUERTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N4O/c6-8-5-7-1-2-9(5)3-4-10/h10H,1-4,6H2,(H,7,8).
What are the key properties of 2-(2-hydrazinyl-4,5-dihydroimidazol-1-yl)ethanol?
2-(2-hydrazinyl-4,5-dihydroimidazol-1-yl)ethanol has a molecular weight of 144.18 g/mol, XLogP of -1.89, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydrazinyl-4,5-dihydroimidazol-1-yl)ethanol is sourced from PubChem (CID 19785397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).