About 2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine
2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine (PubChem CID 19785414) has the molecular formula C9H19N5O
and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine |
| PubChem CID | 19785414 |
| Molecular Formula | C9H19N5O |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine |
| SMILES | NN1CCN=C1NCCN1CCOCC1 |
| InChI | InChI=1S/C9H19N5O/c10-14-4-2-12-9(14)11-1-3-13-5-7-15-8-6-13/h1-8,10H2,(H,11,12) |
| InChIKey | WXTFCMRGLPGNHR-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine?
The IUPAC name of 2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine (CID 19785414) is 2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine.
What is the SMILES notation for 2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine?
The canonical SMILES for 2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine is NN1CCN=C1NCCN1CCOCC1.
What is the InChIKey of 2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine?
The InChIKey is WXTFCMRGLPGNHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N5O/c10-14-4-2-12-9(14)11-1-3-13-5-7-15-8-6-13/h1-8,10H2,(H,11,12).
What are the key properties of 2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine?
2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine has a molecular weight of 213.28 g/mol, XLogP of -1.55, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(2-morpholin-4-ylethyl)-4,5-dihydroimidazole-1,2-diamine is sourced from PubChem (CID 19785414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).