C19H28N2 — CID 19785450
N,N,17-trimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine (PubChem CID 19785450) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is N,N,17-trimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine.
| Compound Name | N,N,17-trimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
|---|---|
| PubChem CID | 19785450 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | N,N,17-trimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
| SMILES | CN(C)c1ccc2c(c1)C13CCCCC1C(C2)N(C)CC3 |
| InChI | InChI=1S/C19H28N2/c1-20(2)15-8-7-14-12-18-16-6-4-5-9-19(16,17(14)13-15)10-11-21(18)3/h7-8,13,16,18H,4-6,9-12H2,1-3H3 |
| InChIKey | YVDZNYZIFGWCEP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |