About (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-(4-bromo-3-oxobutyl)sulfonylpropanoate
(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-(4-bromo-3-oxobutyl)sulfonylpropanoate (PubChem CID 19785798) has the molecular formula C11H15BrNO8S+
and a molecular weight of 401.21 g/mol. Its IUPAC name is (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-(4-bromo-3-oxobutyl)sulfonylpropanoate.
Molecular Properties
| Compound Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-(4-bromo-3-oxobutyl)sulfonylpropanoate |
| PubChem CID | 19785798 |
| Molecular Formula | C11H15BrNO8S+ |
| Molecular Weight | 401.21 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-(4-bromo-3-oxobutyl)sulfonylpropanoate |
| SMILES | O=C(CBr)CCS(=O)(=O)CCC(=O)O[N+]1(O)C(=O)CCC1=O |
| InChI | InChI=1S/C11H15BrNO8S/c12-7-8(14)3-5-22(19,20)6-4-11(17)21-13(18)9(15)1-2-10(13)16/h18H,1-7H2/q+1 |
| InChIKey | ORTSCDQKLRFEDO-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.21 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-(4-bromo-3-oxobutyl)sulfonylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-(4-bromo-3-oxobutyl)sulfonylpropanoate?
The IUPAC name of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-(4-bromo-3-oxobutyl)sulfonylpropanoate (CID 19785798) is (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-(4-bromo-3-oxobutyl)sulfonylpropanoate.
What is the SMILES notation for (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-(4-bromo-3-oxobutyl)sulfonylpropanoate?
The canonical SMILES for (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-(4-bromo-3-oxobutyl)sulfonylpropanoate is O=C(CBr)CCS(=O)(=O)CCC(=O)O[N+]1(O)C(=O)CCC1=O.
What is the InChIKey of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-(4-bromo-3-oxobutyl)sulfonylpropanoate?
The InChIKey is ORTSCDQKLRFEDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrNO8S/c12-7-8(14)3-5-22(19,20)6-4-11(17)21-13(18)9(15)1-2-10(13)16/h18H,1-7H2/q+1.
What are the key properties of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-(4-bromo-3-oxobutyl)sulfonylpropanoate?
(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-(4-bromo-3-oxobutyl)sulfonylpropanoate has a molecular weight of 401.21 g/mol, XLogP of -0.34, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 3-(4-bromo-3-oxobutyl)sulfonylpropanoate is sourced from PubChem (CID 19785798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).