C16H21NO2 — CID 19785892
5-propan-2-yl-3-(2,3,6-trimethylphenyl)pyrrolidine-2,4-dione (PubChem CID 19785892) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 5-propan-2-yl-3-(2,3,6-trimethylphenyl)pyrrolidine-2,4-dione.
| Compound Name | 5-propan-2-yl-3-(2,3,6-trimethylphenyl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 19785892 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 5-propan-2-yl-3-(2,3,6-trimethylphenyl)pyrrolidine-2,4-dione |
| SMILES | Cc1ccc(C)c(C2C(=O)NC(C(C)C)C2=O)c1C |
| InChI | InChI=1S/C16H21NO2/c1-8(2)14-15(18)13(16(19)17-14)12-10(4)7-6-9(3)11(12)5/h6-8,13-14H,1-5H3,(H,17,19) |
| InChIKey | IMFUWWTWXFYRQU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|