About 2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane
2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane (PubChem CID 19786076) has the molecular formula C12H26O
and a molecular weight of 186.34 g/mol. Its IUPAC name is 2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane.
Molecular Properties
| Compound Name | 2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane |
| PubChem CID | 19786076 |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | 2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane |
| SMILES | CC(C)C(C)(C)OC(C)(C)C(C)C |
| InChI | InChI=1S/C12H26O/c1-9(2)11(5,6)13-12(7,8)10(3)4/h9-10H,1-8H3 |
| InChIKey | DVQWBWJZXBYZLA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane?
The IUPAC name of 2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane (CID 19786076) is 2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane.
What is the SMILES notation for 2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane?
The canonical SMILES for 2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane is CC(C)C(C)(C)OC(C)(C)C(C)C.
What is the InChIKey of 2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane?
The InChIKey is DVQWBWJZXBYZLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O/c1-9(2)11(5,6)13-12(7,8)10(3)4/h9-10H,1-8H3.
What are the key properties of 2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane?
2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane has a molecular weight of 186.34 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylbutan-2-yloxy)-2,3-dimethylbutane is sourced from PubChem (CID 19786076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).