C6H6Cl4F6 — CID 19786091
1,2-dichloro-1,1,2-trifluoropropane;2,2-dichloro-1,1,3-trifluoropropane (PubChem CID 19786091) has the molecular formula C6H6Cl4F6 and a molecular weight of 333.91 g/mol. Its IUPAC name is 1,2-dichloro-1,1,2-trifluoropropane;2,2-dichloro-1,1,3-trifluoropropane.
| Compound Name | 1,2-dichloro-1,1,2-trifluoropropane;2,2-dichloro-1,1,3-trifluoropropane |
|---|---|
| PubChem CID | 19786091 |
| Molecular Formula | C6H6Cl4F6 |
| Molecular Weight | 333.91 g/mol |
| Exact Mass | 331.91 |
| IUPAC Name | 1,2-dichloro-1,1,2-trifluoropropane;2,2-dichloro-1,1,3-trifluoropropane |
| SMILES | CC(F)(Cl)C(F)(F)Cl.FCC(Cl)(Cl)C(F)F |
| InChI | InChI=1S/2C3H3Cl2F3/c4-3(5,1-6)2(7)8;1-2(4,6)3(5,7)8/h2H,1H2;1H3 |
| InChIKey | UEGPEUWOWCIEIV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.91 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|