C9H19N3Si3 — CID 19786259
3,4,4-Triethenyl-1,2,2-trimethyl-1,3,5,2,4,6-triazatrisilinane (PubChem CID 19786259) has the molecular formula C9H19N3Si3 and a molecular weight of 253.53 g/mol.
| Compound Name | 3,4,4-Triethenyl-1,2,2-trimethyl-1,3,5,2,4,6-triazatrisilinane |
|---|---|
| PubChem CID | 19786259 |
| Molecular Formula | C9H19N3Si3 |
| Molecular Weight | 253.53 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | — |
| SMILES | C=CN1[Si](C=C)(C=C)N[Si]N(C)[Si]1(C)C |
| InChI | InChI=1S/C9H19N3Si3/c1-7-12-14(5,6)11(4)13-10-15(12,8-2)9-3/h7-10H,1-3H2,4-6H3 |
| InChIKey | KNLJAUIHCQAYAE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.53 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|