C22H24N2O2S — CID 19786685
3-[4-(4-thiophen-3-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole-5-carboxylic acid (PubChem CID 19786685) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 3-[4-(4-thiophen-3-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole-5-carboxylic acid.
| Compound Name | 3-[4-(4-thiophen-3-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 19786685 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 3-[4-(4-thiophen-3-yl-1,2,3,6-tetrahydropyridin-2-yl)butyl]-1H-indole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2[nH]cc(CCCCC3CC(c4ccsc4)=CCN3)c2c1 |
| InChI | InChI=1S/C22H24N2O2S/c25-22(26)16-5-6-21-20(12-16)17(13-24-21)3-1-2-4-19-11-15(7-9-23-19)18-8-10-27-14-18/h5-8,10,12-14,19,23-24H,1-4,9,11H2,(H,25,26) |
| InChIKey | JBCIILZXCISBOC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|