About 3-hydroxy-1-(3-hydroxypropyl)-2,6-dimethylpyridin-4-one
3-hydroxy-1-(3-hydroxypropyl)-2,6-dimethylpyridin-4-one (PubChem CID 19786808) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is 3-hydroxy-1-(3-hydroxypropyl)-2,6-dimethylpyridin-4-one.
Molecular Properties
| Compound Name | 3-hydroxy-1-(3-hydroxypropyl)-2,6-dimethylpyridin-4-one |
| PubChem CID | 19786808 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 3-hydroxy-1-(3-hydroxypropyl)-2,6-dimethylpyridin-4-one |
| SMILES | Cc1cc(=O)c(O)c(C)n1CCCO |
| InChI | InChI=1S/C10H15NO3/c1-7-6-9(13)10(14)8(2)11(7)4-3-5-12/h6,12,14H,3-5H2,1-2H3 |
| InChIKey | LWHVQFZCMOVPDV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-hydroxy-1-(3-hydroxypropyl)-2,6-dimethylpyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1-(3-hydroxypropyl)-2,6-dimethylpyridin-4-one?
The IUPAC name of 3-hydroxy-1-(3-hydroxypropyl)-2,6-dimethylpyridin-4-one (CID 19786808) is 3-hydroxy-1-(3-hydroxypropyl)-2,6-dimethylpyridin-4-one.
What is the SMILES notation for 3-hydroxy-1-(3-hydroxypropyl)-2,6-dimethylpyridin-4-one?
The canonical SMILES for 3-hydroxy-1-(3-hydroxypropyl)-2,6-dimethylpyridin-4-one is Cc1cc(=O)c(O)c(C)n1CCCO.
What is the InChIKey of 3-hydroxy-1-(3-hydroxypropyl)-2,6-dimethylpyridin-4-one?
The InChIKey is LWHVQFZCMOVPDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-7-6-9(13)10(14)8(2)11(7)4-3-5-12/h6,12,14H,3-5H2,1-2H3.
What are the key properties of 3-hydroxy-1-(3-hydroxypropyl)-2,6-dimethylpyridin-4-one?
3-hydroxy-1-(3-hydroxypropyl)-2,6-dimethylpyridin-4-one has a molecular weight of 197.23 g/mol, XLogP of 0.55, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1-(3-hydroxypropyl)-2,6-dimethylpyridin-4-one is sourced from PubChem (CID 19786808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).