About 2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol
2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol (PubChem CID 19786845) has the molecular formula C18H21F2NO
and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol.
Molecular Properties
| Compound Name | 2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol |
| PubChem CID | 19786845 |
| Molecular Formula | C18H21F2NO |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol |
| SMILES | NC(Cc1ccccc1)C(O)C(F)(F)CCc1ccccc1 |
| InChI | InChI=1S/C18H21F2NO/c19-18(20,12-11-14-7-3-1-4-8-14)17(22)16(21)13-15-9-5-2-6-10-15/h1-10,16-17,22H,11-13,21H2 |
| InChIKey | WEDJJIRMFCQVHF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol?
The IUPAC name of 2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol (CID 19786845) is 2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol.
What is the SMILES notation for 2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol?
The canonical SMILES for 2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol is NC(Cc1ccccc1)C(O)C(F)(F)CCc1ccccc1.
What is the InChIKey of 2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol?
The InChIKey is WEDJJIRMFCQVHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21F2NO/c19-18(20,12-11-14-7-3-1-4-8-14)17(22)16(21)13-15-9-5-2-6-10-15/h1-10,16-17,22H,11-13,21H2.
What are the key properties of 2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol?
2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol has a molecular weight of 305.37 g/mol, XLogP of 3.19, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,4-difluoro-1,6-diphenylhexan-3-ol is sourced from PubChem (CID 19786845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).