About phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(N'-methyl-N-nitrocarbamimidoyl)carbamate
phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(N'-methyl-N-nitrocarbamimidoyl)carbamate (PubChem CID 19786885) has the molecular formula C13H12ClN5O4S
and a molecular weight of 369.79 g/mol. Its IUPAC name is phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(N'-methyl-N-nitrocarbamimidoyl)carbamate.
Molecular Properties
| Compound Name | phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(N'-methyl-N-nitrocarbamimidoyl)carbamate |
| PubChem CID | 19786885 |
| Molecular Formula | C13H12ClN5O4S |
| Molecular Weight | 369.79 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(N'-methyl-N-nitrocarbamimidoyl)carbamate |
| SMILES | C/N=C(\N[N+](=O)[O-])N(Cc1cnc(Cl)s1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C13H12ClN5O4S/c1-15-12(17-19(21)22)18(8-10-7-16-11(14)24-10)13(20)23-9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H,15,17) |
| InChIKey | YKEGJEUFYSFVOT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(N'-methyl-N-nitrocarbamimidoyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(N'-methyl-N-nitrocarbamimidoyl)carbamate?
The IUPAC name of phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(N'-methyl-N-nitrocarbamimidoyl)carbamate (CID 19786885) is phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(N'-methyl-N-nitrocarbamimidoyl)carbamate.
What is the SMILES notation for phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(N'-methyl-N-nitrocarbamimidoyl)carbamate?
The canonical SMILES for phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(N'-methyl-N-nitrocarbamimidoyl)carbamate is C/N=C(\N[N+](=O)[O-])N(Cc1cnc(Cl)s1)C(=O)Oc1ccccc1.
What is the InChIKey of phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(N'-methyl-N-nitrocarbamimidoyl)carbamate?
The InChIKey is YKEGJEUFYSFVOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN5O4S/c1-15-12(17-19(21)22)18(8-10-7-16-11(14)24-10)13(20)23-9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H,15,17).
What are the key properties of phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(N'-methyl-N-nitrocarbamimidoyl)carbamate?
phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(N'-methyl-N-nitrocarbamimidoyl)carbamate has a molecular weight of 369.79 g/mol, XLogP of 2.56, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(N'-methyl-N-nitrocarbamimidoyl)carbamate is sourced from PubChem (CID 19786885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).