About 2-chloro-4-(2-methylphenyl)thieno[2,3-b]pyridin-5-amine;ethanol;hydrochloride
2-chloro-4-(2-methylphenyl)thieno[2,3-b]pyridin-5-amine;ethanol;hydrochloride (PubChem CID 19787197) has the molecular formula C16H18Cl2N2OS
and a molecular weight of 357.31 g/mol. Its IUPAC name is 2-chloro-4-(2-methylphenyl)thieno[2,3-b]pyridin-5-amine;ethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-4-(2-methylphenyl)thieno[2,3-b]pyridin-5-amine;ethanol;hydrochloride |
| PubChem CID | 19787197 |
| Molecular Formula | C16H18Cl2N2OS |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2-chloro-4-(2-methylphenyl)thieno[2,3-b]pyridin-5-amine;ethanol;hydrochloride |
| SMILES | CCO.Cc1ccccc1-c1c(N)cnc2sc(Cl)cc12.Cl |
| InChI | InChI=1S/C14H11ClN2S.C2H6O.ClH/c1-8-4-2-3-5-9(8)13-10-6-12(15)18-14(10)17-7-11(13)16;1-2-3;/h2-7H,16H2,1H3;3H,2H2,1H3;1H |
| InChIKey | TZSYDGUNVNXJOJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-4-(2-methylphenyl)thieno[2,3-b]pyridin-5-amine;ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(2-methylphenyl)thieno[2,3-b]pyridin-5-amine;ethanol;hydrochloride?
The IUPAC name of 2-chloro-4-(2-methylphenyl)thieno[2,3-b]pyridin-5-amine;ethanol;hydrochloride (CID 19787197) is 2-chloro-4-(2-methylphenyl)thieno[2,3-b]pyridin-5-amine;ethanol;hydrochloride.
What is the SMILES notation for 2-chloro-4-(2-methylphenyl)thieno[2,3-b]pyridin-5-amine;ethanol;hydrochloride?
The canonical SMILES for 2-chloro-4-(2-methylphenyl)thieno[2,3-b]pyridin-5-amine;ethanol;hydrochloride is CCO.Cc1ccccc1-c1c(N)cnc2sc(Cl)cc12.Cl.
What is the InChIKey of 2-chloro-4-(2-methylphenyl)thieno[2,3-b]pyridin-5-amine;ethanol;hydrochloride?
The InChIKey is TZSYDGUNVNXJOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClN2S.C2H6O.ClH/c1-8-4-2-3-5-9(8)13-10-6-12(15)18-14(10)17-7-11(13)16;1-2-3;/h2-7H,16H2,1H3;3H,2H2,1H3;1H.
What are the key properties of 2-chloro-4-(2-methylphenyl)thieno[2,3-b]pyridin-5-amine;ethanol;hydrochloride?
2-chloro-4-(2-methylphenyl)thieno[2,3-b]pyridin-5-amine;ethanol;hydrochloride has a molecular weight of 357.31 g/mol, XLogP of 4.93, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(2-methylphenyl)thieno[2,3-b]pyridin-5-amine;ethanol;hydrochloride is sourced from PubChem (CID 19787197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).