About 1-[(1-benzyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-1-hydroxyurea
1-[(1-benzyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-1-hydroxyurea (PubChem CID 19787308) has the molecular formula C19H23N3O2
and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-[(1-benzyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-1-hydroxyurea.
Molecular Properties
| Compound Name | 1-[(1-benzyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-1-hydroxyurea |
| PubChem CID | 19787308 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 1-[(1-benzyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-1-hydroxyurea |
| SMILES | CC1CCc2cc(CN(O)C(N)=O)ccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C19H23N3O2/c1-14-7-9-17-11-16(13-22(24)19(20)23)8-10-18(17)21(14)12-15-5-3-2-4-6-15/h2-6,8,10-11,14,24H,7,9,12-13H2,1H3,(H2,20,23) |
| InChIKey | FKEQYZUKEWRGJI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1-benzyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-1-hydroxyurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-benzyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-1-hydroxyurea?
The IUPAC name of 1-[(1-benzyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-1-hydroxyurea (CID 19787308) is 1-[(1-benzyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-1-hydroxyurea.
What is the SMILES notation for 1-[(1-benzyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-1-hydroxyurea?
The canonical SMILES for 1-[(1-benzyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-1-hydroxyurea is CC1CCc2cc(CN(O)C(N)=O)ccc2N1Cc1ccccc1.
What is the InChIKey of 1-[(1-benzyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-1-hydroxyurea?
The InChIKey is FKEQYZUKEWRGJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O2/c1-14-7-9-17-11-16(13-22(24)19(20)23)8-10-18(17)21(14)12-15-5-3-2-4-6-15/h2-6,8,10-11,14,24H,7,9,12-13H2,1H3,(H2,20,23).
What are the key properties of 1-[(1-benzyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-1-hydroxyurea?
1-[(1-benzyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-1-hydroxyurea has a molecular weight of 325.41 g/mol, XLogP of 3.30, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-benzyl-2-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]-1-hydroxyurea is sourced from PubChem (CID 19787308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).