About N-tert-butyl-4,4-dimethylcyclopent-2-en-1-amine;hydrochloride
N-tert-butyl-4,4-dimethylcyclopent-2-en-1-amine;hydrochloride (PubChem CID 19787481) has the molecular formula C11H22ClN
and a molecular weight of 203.76 g/mol. Its IUPAC name is N-tert-butyl-4,4-dimethylcyclopent-2-en-1-amine;hydrochloride.
Molecular Properties
| Compound Name | N-tert-butyl-4,4-dimethylcyclopent-2-en-1-amine;hydrochloride |
| PubChem CID | 19787481 |
| Molecular Formula | C11H22ClN |
| Molecular Weight | 203.76 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | N-tert-butyl-4,4-dimethylcyclopent-2-en-1-amine;hydrochloride |
| SMILES | CC1(C)C=CC(NC(C)(C)C)C1.Cl |
| InChI | InChI=1S/C11H21N.ClH/c1-10(2,3)12-9-6-7-11(4,5)8-9;/h6-7,9,12H,8H2,1-5H3;1H |
| InChIKey | WKQMASALMHIAME-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.76 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-4,4-dimethylcyclopent-2-en-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-4,4-dimethylcyclopent-2-en-1-amine;hydrochloride?
The IUPAC name of N-tert-butyl-4,4-dimethylcyclopent-2-en-1-amine;hydrochloride (CID 19787481) is N-tert-butyl-4,4-dimethylcyclopent-2-en-1-amine;hydrochloride.
What is the SMILES notation for N-tert-butyl-4,4-dimethylcyclopent-2-en-1-amine;hydrochloride?
The canonical SMILES for N-tert-butyl-4,4-dimethylcyclopent-2-en-1-amine;hydrochloride is CC1(C)C=CC(NC(C)(C)C)C1.Cl.
What is the InChIKey of N-tert-butyl-4,4-dimethylcyclopent-2-en-1-amine;hydrochloride?
The InChIKey is WKQMASALMHIAME-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N.ClH/c1-10(2,3)12-9-6-7-11(4,5)8-9;/h6-7,9,12H,8H2,1-5H3;1H.
What are the key properties of N-tert-butyl-4,4-dimethylcyclopent-2-en-1-amine;hydrochloride?
N-tert-butyl-4,4-dimethylcyclopent-2-en-1-amine;hydrochloride has a molecular weight of 203.76 g/mol, XLogP of 3.15, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-4,4-dimethylcyclopent-2-en-1-amine;hydrochloride is sourced from PubChem (CID 19787481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).