About zinc;1-(4-diazo-2-methylcyclohexa-1,5-dien-1-yl)pyrrolidine;chloride
zinc;1-(4-diazo-2-methylcyclohexa-1,5-dien-1-yl)pyrrolidine;chloride (PubChem CID 19787591) has the molecular formula C11H15ClN3Zn+
and a molecular weight of 290.10 g/mol. Its IUPAC name is zinc;1-(4-diazo-2-methylcyclohexa-1,5-dien-1-yl)pyrrolidine;chloride.
Molecular Properties
| Compound Name | zinc;1-(4-diazo-2-methylcyclohexa-1,5-dien-1-yl)pyrrolidine;chloride |
| PubChem CID | 19787591 |
| Molecular Formula | C11H15ClN3Zn+ |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | zinc;1-(4-diazo-2-methylcyclohexa-1,5-dien-1-yl)pyrrolidine;chloride |
| SMILES | CC1=C(N2CCCC2)C=CC(=[N+]=[N-])C1.[Cl-].[Zn+2] |
| InChI | InChI=1S/C11H15N3.ClH.Zn/c1-9-8-10(13-12)4-5-11(9)14-6-2-3-7-14;;/h4-5H,2-3,6-8H2,1H3;1H;/q;;+2/p-1 |
| InChIKey | ZLIUGFLEZNAEFV-UHFFFAOYSA-M |
| XLogP | -1.01 |
| TPSA | 39.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze zinc;1-(4-diazo-2-methylcyclohexa-1,5-dien-1-yl)pyrrolidine;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;1-(4-diazo-2-methylcyclohexa-1,5-dien-1-yl)pyrrolidine;chloride?
The IUPAC name of zinc;1-(4-diazo-2-methylcyclohexa-1,5-dien-1-yl)pyrrolidine;chloride (CID 19787591) is zinc;1-(4-diazo-2-methylcyclohexa-1,5-dien-1-yl)pyrrolidine;chloride.
What is the SMILES notation for zinc;1-(4-diazo-2-methylcyclohexa-1,5-dien-1-yl)pyrrolidine;chloride?
The canonical SMILES for zinc;1-(4-diazo-2-methylcyclohexa-1,5-dien-1-yl)pyrrolidine;chloride is CC1=C(N2CCCC2)C=CC(=[N+]=[N-])C1.[Cl-].[Zn+2].
What is the InChIKey of zinc;1-(4-diazo-2-methylcyclohexa-1,5-dien-1-yl)pyrrolidine;chloride?
The InChIKey is ZLIUGFLEZNAEFV-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H15N3.ClH.Zn/c1-9-8-10(13-12)4-5-11(9)14-6-2-3-7-14;;/h4-5H,2-3,6-8H2,1H3;1H;/q;;+2/p-1.
What are the key properties of zinc;1-(4-diazo-2-methylcyclohexa-1,5-dien-1-yl)pyrrolidine;chloride?
zinc;1-(4-diazo-2-methylcyclohexa-1,5-dien-1-yl)pyrrolidine;chloride has a molecular weight of 290.10 g/mol, XLogP of -1.01, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;1-(4-diazo-2-methylcyclohexa-1,5-dien-1-yl)pyrrolidine;chloride is sourced from PubChem (CID 19787591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).