About 4-(dimethylamino)-2,6-dimethylbenzaldehyde
4-(dimethylamino)-2,6-dimethylbenzaldehyde (PubChem CID 19787691) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-(dimethylamino)-2,6-dimethylbenzaldehyde.
Molecular Properties
| Compound Name | 4-(dimethylamino)-2,6-dimethylbenzaldehyde |
| PubChem CID | 19787691 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 4-(dimethylamino)-2,6-dimethylbenzaldehyde |
| SMILES | Cc1cc(N(C)C)cc(C)c1C=O |
| InChI | InChI=1S/C11H15NO/c1-8-5-10(12(3)4)6-9(2)11(8)7-13/h5-7H,1-4H3 |
| InChIKey | ADDNDYGTXADGMI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)-2,6-dimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-2,6-dimethylbenzaldehyde?
The IUPAC name of 4-(dimethylamino)-2,6-dimethylbenzaldehyde (CID 19787691) is 4-(dimethylamino)-2,6-dimethylbenzaldehyde.
What is the SMILES notation for 4-(dimethylamino)-2,6-dimethylbenzaldehyde?
The canonical SMILES for 4-(dimethylamino)-2,6-dimethylbenzaldehyde is Cc1cc(N(C)C)cc(C)c1C=O.
What is the InChIKey of 4-(dimethylamino)-2,6-dimethylbenzaldehyde?
The InChIKey is ADDNDYGTXADGMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-8-5-10(12(3)4)6-9(2)11(8)7-13/h5-7H,1-4H3.
What are the key properties of 4-(dimethylamino)-2,6-dimethylbenzaldehyde?
4-(dimethylamino)-2,6-dimethylbenzaldehyde has a molecular weight of 177.25 g/mol, XLogP of 2.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-2,6-dimethylbenzaldehyde is sourced from PubChem (CID 19787691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).