C18H33O3P — CID 19787713
[(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienyl]phosphonic acid (PubChem CID 19787713) has the molecular formula C18H33O3P and a molecular weight of 328.43 g/mol. Its IUPAC name is [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienyl]phosphonic acid.
| Compound Name | [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienyl]phosphonic acid |
|---|---|
| PubChem CID | 19787713 |
| Molecular Formula | C18H33O3P |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | [(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCCCP(=O)(O)O |
| InChI | InChI=1S/C18H33O3P/c1-16(2)10-8-12-18(4)14-9-13-17(3)11-6-5-7-15-22(19,20)21/h10-11,14H,5-9,12-13,15H2,1-4H3,(H2,19,20,21)/b17-11+,18-14+ |
| InChIKey | AEYSUBKSILBNEA-CBXDKUCNSA-N |
| XLogP | 5.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|